| Name | Methoxybenzoquinone |
| Synonyms | CCRIS 7149 NSC 508876 Methoxybenzoquinone 2-Methoxy-p-benzoquinone 2-methoxycyclohexa-2,5-diene-1,4-dione |
| CAS | 2880-58-2 |
| InChI | InChI=1/C7H6O3/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,1H3 |
| Molecular Formula | C7H6O3 |
| Molar Mass | 138.12 |
| Density | 1.22g/cm3 |
| Melting Point | 147°C |
| Boling Point | 246.7°C at 760 mmHg |
| Flash Point | 105.9°C |
| Vapor Presure | 0.0267mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.513 |
| MDL | MFCD00144755 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| storage conditions | Sealed in dry,2-8°C |